Products 1352491-75-8
CAS 1352491-75-8 appears in our catalog under these names: Ramosetron Impurity 6, 3-(1-Methyl-1H-indole-3-carbonyl)hexanedioic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5000mg.
3-(1-methylindole-3-carbonyl)hexanedioic acid (CAS 1352491-75-8) is a chemical compound with the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. IUPAC name: 3-(1-methylindole-3-carbonyl)hexanedioic acid. InChIKey: ACUKZGBIUXHMRX-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | 3-(1-methylindole-3-carbonyl)hexanedioic acid |
| InChIKey | ACUKZGBIUXHMRX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)C(CCC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)