CAS 851903-42-9 appears in our catalog under these names: (2E)-3-(4-[(3,5-Dimethylisoxazol-4-yl)methoxy]-3-methoxyphenyl)acrylic acid, 95%, 3-{4-((dimethyl-1,2-oxazol-4-yl)methoxy)-3-methoxyphenyl}prop-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoic acid (CAS 851903-42-9) is a chemical compound with the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. IUPAC name: (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoic acid. InChIKey: AGHIZDYJLUTOLB-FNORWQNLSA-N.
| Molecular formula | C16H17NO5 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoic acid |
| InChIKey | AGHIZDYJLUTOLB-FNORWQNLSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=C(C=C(C=C2)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)