Products 15958-86-8

CAS 15958-86-8 appears in our catalog under these names: N-(4-Hydroxyphenyl)-3,4,5-trimethoxybenzamide, 95%, N-(4-Hydroxyphenyl)-3,4,5-trimethoxybenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

N-(4-hydroxyphenyl)-3,4,5-trimethoxybenzamide (CAS 15958-86-8) is a chemical compound with the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. IUPAC name: N-(4-hydroxyphenyl)-3,4,5-trimethoxybenzamide. InChIKey: PZIHJGHUNPWCFT-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO5
Molecular weight303.31 g/mol
IUPAC nameN-(4-hydroxyphenyl)-3,4,5-trimethoxybenzamide
InChIKeyPZIHJGHUNPWCFT-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(=O)NC2=CC=C(C=C2)O

Computed by PubChem (NCBI)