CAS 850374-95-7 is the registry number for 1-tert-Butyl 6-methyl 3-formyl-1h-indole-1,6-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-O-tert-butyl 6-O-methyl 3-formylindole-1,6-dicarboxylate (CAS 850374-95-7) is a chemical compound with the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 3-formylindole-1,6-dicarboxylate. InChIKey: ZWBQQPNSHLBCRE-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 3-formylindole-1,6-dicarboxylate |
| InChIKey | ZWBQQPNSHLBCRE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)C(=O)OC)C=O |
Computed by PubChem (NCBI)