CAS 2731414-28-9 is the registry number for Oxolinic Acid Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Propan-2-yl 5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate (CAS 2731414-28-9) is a chemical compound with the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. IUPAC name: propan-2-yl 5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate. InChIKey: UDXWOFWLQMPIBD-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | propan-2-yl 5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate |
| InChIKey | UDXWOFWLQMPIBD-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)OC(C)C |
Computed by PubChem (NCBI)