Products 1352879-70-9
CAS 1352879-70-9 is the registry number for 3,5-Dimethylbenzimidamide hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dimethylbenzenecarboximidamide;hydrochloride (CAS 1352879-70-9) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 3,5-dimethylbenzenecarboximidamide;hydrochloride. InChIKey: RZUDKJGNNNOUGJ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2 |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 3,5-dimethylbenzenecarboximidamide;hydrochloride |
| InChIKey | RZUDKJGNNNOUGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=N)N)C.Cl |
Computed by PubChem (NCBI)