Products 1352906-43-4
CAS 1352906-43-4 is the registry number for (1,3)Oxazolo(4,5-b)pyridine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,005g, 0,01g, 0,025g, 0,05g, 0,1g.
[1,3]oxazolo[4,5-b]pyridine-5-carboxylic acid (CAS 1352906-43-4) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: [1,3]oxazolo[4,5-b]pyridine-5-carboxylic acid. InChIKey: DRTYPAMVDUGLQJ-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | [1,3]oxazolo[4,5-b]pyridine-5-carboxylic acid |
| InChIKey | DRTYPAMVDUGLQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1OC=N2)C(=O)O |
Computed by PubChem (NCBI)