Products 135304-48-2
CAS 135304-48-2 is the registry number for 2’-Amino-2’-deoxy-β-D-arabino-5-methyl uridine. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg, 50 mg.
1-[(2R,3S,4S,5R)-3-amino-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 135304-48-2) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: 1-[(2R,3S,4S,5R)-3-amino-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: VGYZEXPNNAEQKL-JVZYCSMKSA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 1-[(2R,3S,4S,5R)-3-amino-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | VGYZEXPNNAEQKL-JVZYCSMKSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)N |
Computed by PubChem (NCBI)