CAS 1353856-95-7 appears in our catalog under these names: 4,6-Dichloro-2-cyclobutylpyrimidine, 98%, 4,6-Dichloro-2-cyclobutylpyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,6-dichloro-2-cyclobutylpyrimidine (CAS 1353856-95-7) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 4,6-dichloro-2-cyclobutylpyrimidine. InChIKey: FEPXBNBIBVQUQC-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 4,6-dichloro-2-cyclobutylpyrimidine |
| InChIKey | FEPXBNBIBVQUQC-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)