Products 1353949-71-9
CAS 1353949-71-9 appears in our catalog under these names: JBPOS-0101, JBPOS-0101, >95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 100mg, 250mg.
[(1S,2S)-1-(2-chlorophenyl)-1-hydroxypropan-2-yl] carbamate (CAS 1353949-71-9) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: [(1S,2S)-1-(2-chlorophenyl)-1-hydroxypropan-2-yl] carbamate. InChIKey: TZOWVYPYWJLZTK-IMTBSYHQSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | [(1S,2S)-1-(2-chlorophenyl)-1-hydroxypropan-2-yl] carbamate |
| InChIKey | TZOWVYPYWJLZTK-IMTBSYHQSA-N |
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1Cl)O)OC(=O)N |
Computed by PubChem (NCBI)