CAS 135432-77-8 appears in our catalog under these names: 6-(4-Chlorophenyl)picolinic acid, 98%, 6-(4-Chlorophenyl)picolinic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 500mg, 250mg, 1000mg, 5000mg, 2000mg.
6-(4-chlorophenyl)pyridine-2-carboxylic acid (CAS 135432-77-8) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 6-(4-chlorophenyl)pyridine-2-carboxylic acid. InChIKey: JFMADCMXBNACFK-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 6-(4-chlorophenyl)pyridine-2-carboxylic acid |
| InChIKey | JFMADCMXBNACFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)