Products 1354428-17-3
CAS 1354428-17-3 appears in our catalog under these names: 2,3-diaminobenzoic acid hydrochloride, 95%, 2,3-DIaminobenzoic acid hydrochloride 95%, 2,3-DIaminobenzoic acid hydrochloride, 95%,RG. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat. Available pack sizes: 5g, 10g, 1g, 100g, 25g.
2,3-diaminobenzoic acid;hydrochloride (CAS 1354428-17-3) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 2,3-diaminobenzoic acid;hydrochloride. InChIKey: OMWNWENDHSMOPJ-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 2,3-diaminobenzoic acid;hydrochloride |
| InChIKey | OMWNWENDHSMOPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C(=O)O.Cl |
Computed by PubChem (NCBI)