Products 1354790-56-9
CAS 1354790-56-9 appears in our catalog under these names: DMT1 blocker 1/ 100%, DMT1 blocker 1, 99.79%, DMT1 blocker 1. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM/1mL.
5-methyl-3-oxo-N-phenyl-2-pyridin-2-yl-1H-pyrazole-4-carboxamide (CAS 1354790-56-9) is a chemical compound with the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. IUPAC name: 5-methyl-3-oxo-N-phenyl-2-pyridin-2-yl-1H-pyrazole-4-carboxamide. InChIKey: QJEBTCLOCMTSJU-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O2 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | 5-methyl-3-oxo-N-phenyl-2-pyridin-2-yl-1H-pyrazole-4-carboxamide |
| InChIKey | QJEBTCLOCMTSJU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1)C2=CC=CC=N2)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)