Products 2411698-59-2
CAS 2411698-59-2 is the registry number for Xanthine oxidase-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-cyclopentyl-5-(5-oxo-4H-1,2,4-oxadiazol-3-yl)indole-3-carbonitrile (CAS 2411698-59-2) is a chemical compound with the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. IUPAC name: 1-cyclopentyl-5-(5-oxo-4H-1,2,4-oxadiazol-3-yl)indole-3-carbonitrile. InChIKey: DLCGGKMVKHIBSQ-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O2 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | 1-cyclopentyl-5-(5-oxo-4H-1,2,4-oxadiazol-3-yl)indole-3-carbonitrile |
| InChIKey | DLCGGKMVKHIBSQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C=C(C3=C2C=CC(=C3)C4=NOC(=O)N4)C#N |
Computed by PubChem (NCBI)
Synonyms:
Xanthine oxidase-IN-7, orb1689401