CAS 530112-00-6 is the registry number for RS-0406. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[6-(3-hydroxyanilino)pyridazin-3-yl]amino]phenol (CAS 530112-00-6) is a chemical compound with the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. IUPAC name: 3-[[6-(3-hydroxyanilino)pyridazin-3-yl]amino]phenol. InChIKey: GYNDFOLSPPBBIK-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O2 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | 3-[[6-(3-hydroxyanilino)pyridazin-3-yl]amino]phenol |
| InChIKey | GYNDFOLSPPBBIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)NC2=NN=C(C=C2)NC3=CC(=CC=C3)O |
Computed by PubChem (NCBI)