CAS 1354952-33-2 appears in our catalog under these names: 2-(1,2,3,4-Tetrahydroquinolin-8-yl)ethan-1-amine dihydrochloride, 95%, 2-(1,2,3,4-Tetrahydroquinolin-8-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(1,2,3,4-tetrahydroquinolin-8-yl)ethanamine;dihydrochloride (CAS 1354952-33-2) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 2-(1,2,3,4-tetrahydroquinolin-8-yl)ethanamine;dihydrochloride. InChIKey: XUKXKIUEGKYDLT-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 2-(1,2,3,4-tetrahydroquinolin-8-yl)ethanamine;dihydrochloride |
| InChIKey | XUKXKIUEGKYDLT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC=C2)CCN)NC1.Cl.Cl |
Computed by PubChem (NCBI)