CAS 1354957-99-5 is the registry number for 2-Chloro-N-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetamide (CAS 1354957-99-5) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 2-chloro-N-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetamide. InChIKey: RLBHFYVFVXOPST-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-chloro-N-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)acetamide |
| InChIKey | RLBHFYVFVXOPST-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NOC(=N2)NC(=O)CCl |
Computed by PubChem (NCBI)