Products 1355011-22-1
CAS 1355011-22-1 appears in our catalog under these names: 2-(2,6-Difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(2,6-Difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(2,6-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1355011-22-1) is a chemical compound with the molecular formula C13H17BF2O2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(2,6-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: URSNZAWXXUNYQG-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(2,6-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | URSNZAWXXUNYQG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2F)C)F |
Computed by PubChem (NCBI)