Products 1355068-59-5
CAS 1355068-59-5 is the registry number for 3-chloro-2-(2,2,2-trifluoroethoxy)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-chloro-2-(2,2,2-trifluoroethoxy)pyridine (CAS 1355068-59-5) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 3-chloro-2-(2,2,2-trifluoroethoxy)pyridine. InChIKey: OPHKOTDXPHQBSI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 3-chloro-2-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | OPHKOTDXPHQBSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)