Products 1355172-95-0
CAS 1355172-95-0 appears in our catalog under these names: 6-(Benzyloxy)-2-methylnicotinic acid, 95%, 6-(Benzyloxy)-2-methylnicotinic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg, 500mg.
2-methyl-6-phenylmethoxypyridine-3-carboxylic acid (CAS 1355172-95-0) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 2-methyl-6-phenylmethoxypyridine-3-carboxylic acid. InChIKey: ZOBDRGGYULBDGX-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 2-methyl-6-phenylmethoxypyridine-3-carboxylic acid |
| InChIKey | ZOBDRGGYULBDGX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-(Benzyloxy)-2-methylnicotinic Acid, 6-(benzyloxy)-2-methylpyridine-3-carboxylic acid, 6-Benzyloxy-2-methylpyridine-3-carboxylic acid, 2-methyl-6-phenylmethoxypyridine-3-carboxylic acid, 6-Benzyloxy-2-methyl-pyridine-3-carboxylic acid, 6-(Benzyloxy)-2-methylnicotinicAcid, 2-Methyl-6-(phenylmethoxy)-3-pyridinecarboxylic acid