CAS 1355609-57-2 is the registry number for 4-(1,3-Dioxaindan-5-yl)-5-cyclopropyl-2-methyl-2,3-dihydro-1H-pyrazol-3-imine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,3-benzodioxol-5-yl)-3-cyclopropyl-1-methylpyrazol-5-amine (CAS 1355609-57-2) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-3-cyclopropyl-1-methylpyrazol-5-amine. InChIKey: ZGGSYDHZORXPTM-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-3-cyclopropyl-1-methylpyrazol-5-amine |
| InChIKey | ZGGSYDHZORXPTM-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C2CC2)C3=CC4=C(C=C3)OCO4)N |
Computed by PubChem (NCBI)