Products 135566-66-4
CAS 135566-66-4 is the registry number for 5,5-dimethyl-3-((4-(phenylamino)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one (CAS 135566-66-4) is a chemical compound with the molecular formula C20H22N2O and a molecular weight of 306.4 g/mol. IUPAC name: 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one. InChIKey: XPDVZCSPFJQAGU-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one |
| InChIKey | XPDVZCSPFJQAGU-UHFFFAOYSA-N |
| SMILES | CC1(CC(=CC(=O)C1)NC2=CC=C(C=C2)NC3=CC=CC=C3)C |
Computed by PubChem (NCBI)