Products 1356016-31-3
CAS 1356016-31-3 is the registry number for 3-Methoxy-N,N-dimethyl-4-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-methoxy-N,N-dimethyl-4-nitrobenzamide (CAS 1356016-31-3) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 3-methoxy-N,N-dimethyl-4-nitrobenzamide. InChIKey: QZWZUKDSLNQYNM-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 3-methoxy-N,N-dimethyl-4-nitrobenzamide |
| InChIKey | QZWZUKDSLNQYNM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)