CAS 135631-89-9 is the registry number for 2–Butenamide, N–(4–bromophenyl)–3–methyl–. Offered by: GLPBio. Available pack sizes: 200mg.
N-(4-bromophenyl)-3-methylbut-2-enamide (CAS 135631-89-9) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: N-(4-bromophenyl)-3-methylbut-2-enamide. InChIKey: BJPQRVCCAISNSI-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | N-(4-bromophenyl)-3-methylbut-2-enamide |
| InChIKey | BJPQRVCCAISNSI-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)NC1=CC=C(C=C1)Br)C |
Computed by PubChem (NCBI)