Products 1356354-32-9
CAS 1356354-32-9 is the registry number for (AlphaS)-Alpha-(((1S)-1-Carboxyethyl)amino)benzenebutanoic Acid 1-Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2S)-2-[[(2S)-1-methoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid (CAS 1356354-32-9) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-2-[[(2S)-1-methoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid. InChIKey: HUNRUXGZJNTAJK-JQWIXIFHSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-methoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid |
| InChIKey | HUNRUXGZJNTAJK-JQWIXIFHSA-N |
| SMILES | C[C@@H](C(=O)O)N[C@@H](CCC1=CC=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)