Products 135641-91-7
CAS 135641-91-7 appears in our catalog under these names: 3-(4-Chlorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 5-(4-Chlorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 3-(4-Chlorophenyl)-1H-pyrazole-4-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg.
5-(4-chlorophenyl)-1H-pyrazole-4-carboxylic acid (CAS 135641-91-7) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 5-(4-chlorophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: QOICGDIFQWOONP-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | QOICGDIFQWOONP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NN2)C(=O)O)Cl |
Computed by PubChem (NCBI)