Products 1356412-82-2
CAS 1356412-82-2 appears in our catalog under these names: 5-Bromo-2-nitroisonicotinic acid 98%, 5-Bromo-2-nitroisonicotinic acid, 98%, 5-bromo-2-nitropyridine-4-carboxylic acid, 5-Bromo-2-nitroisonicotinic acid, 98%, 98%. Offered by: Ambeed, Fluorochem, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g.
5-bromo-2-nitropyridine-4-carboxylic acid (CAS 1356412-82-2) is a chemical compound with the molecular formula C6H3BrN2O4 and a molecular weight of 247.00 g/mol. IUPAC name: 5-bromo-2-nitropyridine-4-carboxylic acid. InChIKey: MPPXDSQZQIBCRT-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O4 |
|---|---|
| Molecular weight | 247.00 g/mol |
| IUPAC name | 5-bromo-2-nitropyridine-4-carboxylic acid |
| InChIKey | MPPXDSQZQIBCRT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)