CAS 951126-40-2 is the registry number for 1-Bromo-2,4-dinitro-benzene-1,2,3,4,5,6-13C6. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
1-bromo-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 951126-40-2) is a chemical compound with the molecular formula C6H3BrN2O4 and a molecular weight of 252.96 g/mol. IUPAC name: 1-bromo-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: PBOPJYORIDJAFE-IDEBNGHGSA-N.
| Molecular formula | C6H3BrN2O4 |
|---|---|
| Molecular weight | 252.96 g/mol |
| IUPAC name | 1-bromo-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | PBOPJYORIDJAFE-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1[N+](=O)[O-])[N+](=O)[O-])Br |
Computed by PubChem (NCBI)