Products 914222-92-7
CAS 914222-92-7 appears in our catalog under these names: 2-bromo-5-nitropyridine-3-carboxylic acid, 2-Bromo-5-nitronicotinic acid 95%, 2-BROMO-5-NITRONICOTINIC ACID, 95%, 95%, 2-Bromo-5-nitropyridine-3-carboxylic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 1g.
2-bromo-5-nitropyridine-3-carboxylic acid (CAS 914222-92-7) is a chemical compound with the molecular formula C6H3BrN2O4 and a molecular weight of 247.00 g/mol. IUPAC name: 2-bromo-5-nitropyridine-3-carboxylic acid. InChIKey: TZALTHQYRONLQA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O4 |
|---|---|
| Molecular weight | 247.00 g/mol |
| IUPAC name | 2-bromo-5-nitropyridine-3-carboxylic acid |
| InChIKey | TZALTHQYRONLQA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)