CAS 66092-63-5 appears in our catalog under these names: 6-Bromo-4-nitronicotinic acid, 95%, 6-Bromo-4-nitronicotinic acid, 95+%, 6–Bromo–4–nitronicotinic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-bromo-4-nitropyridine-3-carboxylic acid (CAS 66092-63-5) is a chemical compound with the molecular formula C6H3BrN2O4 and a molecular weight of 247.00 g/mol. IUPAC name: 6-bromo-4-nitropyridine-3-carboxylic acid. InChIKey: DXCCKVXDMGBPDN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O4 |
|---|---|
| Molecular weight | 247.00 g/mol |
| IUPAC name | 6-bromo-4-nitropyridine-3-carboxylic acid |
| InChIKey | DXCCKVXDMGBPDN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)