CAS 27465-66-3 is the registry number for 3-(4-Bromophenyl)-2-propenoyl chloride, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
3-(4-bromophenyl)prop-2-enoyl chloride (CAS 27465-66-3) is a chemical compound with the molecular formula C9H6BrClO and a molecular weight of 245.50 g/mol. IUPAC name: 3-(4-bromophenyl)prop-2-enoyl chloride. InChIKey: YLABICHHIYWLQM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 3-(4-bromophenyl)prop-2-enoyl chloride |
| InChIKey | YLABICHHIYWLQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC(=O)Cl)Br |
Computed by PubChem (NCBI)