CAS 135690-29-8 appears in our catalog under these names: 2-Amino-4,6-dibromobenzaldehyde, 95%, 2-Amino-4,6-dibromobenzaldehyde, 97%, 2-amino-4,6-dibromobenzaldehyde, 97%, 97%, 2-AMINO-4,6-DIBROMO-BENZALDEHYDE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg, 500mg.
2-amino-4,6-dibromobenzaldehyde (CAS 135690-29-8) is a chemical compound with the molecular formula C7H5Br2NO and a molecular weight of 278.93 g/mol. IUPAC name: 2-amino-4,6-dibromobenzaldehyde. InChIKey: AQACHPDXIQVYSO-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO |
|---|---|
| Molecular weight | 278.93 g/mol |
| IUPAC name | 2-amino-4,6-dibromobenzaldehyde |
| InChIKey | AQACHPDXIQVYSO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)C=O)Br)Br |
Computed by PubChem (NCBI)