CAS 42460-62-8 appears in our catalog under these names: Ambroxol Impurity 26, Ambroxol Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3,5-dibromobenzaldehyde (CAS 42460-62-8) is a chemical compound with the molecular formula C7H5Br2NO and a molecular weight of 278.93 g/mol. IUPAC name: 4-amino-3,5-dibromobenzaldehyde. InChIKey: QHFGYJWGASPRHW-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO |
|---|---|
| Molecular weight | 278.93 g/mol |
| IUPAC name | 4-amino-3,5-dibromobenzaldehyde |
| InChIKey | QHFGYJWGASPRHW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C=O |
Computed by PubChem (NCBI)