CAS 175205-85-3 appears in our catalog under these names: 3,5-Dibromobenzamide, 95%, 3,5–Dibromobenzamide, 3,5-Dibromobenzamide, 3,5-Dibromobenzamide, 97% , 3,5-Dibromobenzamide, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific, Fluorochem. Available pack sizes: 5g, 25g, 1g, 500mg, 10g.
3,5-dibromobenzamide (CAS 175205-85-3) is a chemical compound with the molecular formula C7H5Br2NO and a molecular weight of 278.93 g/mol. IUPAC name: 3,5-dibromobenzamide. InChIKey: IOFGMNBDIDEBIQ-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO |
|---|---|
| Molecular weight | 278.93 g/mol |
| IUPAC name | 3,5-dibromobenzamide |
| InChIKey | IOFGMNBDIDEBIQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)C(=O)N |
Computed by PubChem (NCBI)