CAS 874522-46-0 appears in our catalog under these names: 2,4-Dibromo-benzamide, 95%, 2,4-Dibromobenzamide 97%, 2,4-Dibromobenzamide, 97%, 97%, 2,4-DIBROMOBENZAMIDE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
2,4-dibromobenzamide (CAS 874522-46-0) is a chemical compound with the molecular formula C7H5Br2NO and a molecular weight of 278.93 g/mol. IUPAC name: 2,4-dibromobenzamide. InChIKey: RYCQHJGPQUMDLI-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO |
|---|---|
| Molecular weight | 278.93 g/mol |
| IUPAC name | 2,4-dibromobenzamide |
| InChIKey | RYCQHJGPQUMDLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)C(=O)N |
Computed by PubChem (NCBI)