Products 1357155-90-8
CAS 1357155-90-8 appears in our catalog under these names: 3-(4-(Methoxycarbonyl)phenyl)propiolic acid, 98%, 98%, 3-(4-(Methoxycarbonyl)phenyl)propiolic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
3-(4-methoxycarbonylphenyl)prop-2-ynoic acid (CAS 1357155-90-8) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(4-methoxycarbonylphenyl)prop-2-ynoic acid. InChIKey: LQGZAFUGYHMCEG-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-(4-methoxycarbonylphenyl)prop-2-ynoic acid |
| InChIKey | LQGZAFUGYHMCEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C#CC(=O)O |
Computed by PubChem (NCBI)