CAS 1357387-81-5 is the registry number for 2-Bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1357387-81-5) is a chemical compound with the molecular formula C12H17BBrNO3 and a molecular weight of 313.99 g/mol. IUPAC name: 2-bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: IGZDSVOBSNWDLY-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO3 |
|---|---|
| Molecular weight | 313.99 g/mol |
| IUPAC name | 2-bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | IGZDSVOBSNWDLY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)Br)OC |
Computed by PubChem (NCBI)