CAS 2096334-49-3 appears in our catalog under these names: 2-Bromo-5-methoxypyridine-4-boronic acid, pinacol ester, 98%, 2-Bromo-5-methoxypyridine-4-boronic acid, pinacol ester, 97%, 97%, 2-Bromo-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-bromo-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2096334-49-3) is a chemical compound with the molecular formula C12H17BBrNO3 and a molecular weight of 313.99 g/mol. IUPAC name: 2-bromo-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: KHUJCKRTJFOPOE-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO3 |
|---|---|
| Molecular weight | 313.99 g/mol |
| IUPAC name | 2-bromo-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | KHUJCKRTJFOPOE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2OC)Br |
Computed by PubChem (NCBI)