CAS 2223040-05-7 appears in our catalog under these names: 3-Bromo-2-methoxypyridine-5-boronic acid pinacol ester, 98%, 3-Bromo-2-methoxypyridine-5-boronic acid pinacol ester, 95%, 3-Bromo-2-methoxypyridine-5-boronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
3-bromo-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223040-05-7) is a chemical compound with the molecular formula C12H17BBrNO3 and a molecular weight of 313.99 g/mol. IUPAC name: 3-bromo-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: WALDKLDBKMQUTE-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO3 |
|---|---|
| Molecular weight | 313.99 g/mol |
| IUPAC name | 3-bromo-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | WALDKLDBKMQUTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OC)Br |
Computed by PubChem (NCBI)