CAS 1402227-31-9 is the registry number for 3-Bromo-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1402227-31-9) is a chemical compound with the molecular formula C12H17BBrNO3 and a molecular weight of 313.99 g/mol. IUPAC name: 3-bromo-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: WPDXJRITINVJGN-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO3 |
|---|---|
| Molecular weight | 313.99 g/mol |
| IUPAC name | 3-bromo-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | WPDXJRITINVJGN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)OC)Br |
Computed by PubChem (NCBI)