CAS 135743-12-3 is the registry number for Myrsinoic Acid A. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
Myrsinoic acid A is a monohydroxybenzoic acid that is 4-hydroxybenzoic acid substituted by a geranyl group at position 3 and a prenyl group at position 5. Isolated from Myrsine seguinii, it exhibits anti-inflammatory activity. It has a role as a metabolite, an antineoplastic agent, an anti-inflammatory agent and an EC 4.4.1.11 (methionine gamma-lyase) inhibitor.
Source: ChEBI
| Molecular formula | C22H30O3 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-(3-methylbut-2-enyl)benzoic acid |
| InChIKey | SUXGLLRPXXXJER-LICLKQGHSA-N |
| SMILES | CC(=CCC/C(=C/CC1=CC(=CC(=C1O)CC=C(C)C)C(=O)O)/C)C |
Computed by PubChem (NCBI)