Products 13575-74-1
CAS 13575-74-1 appears in our catalog under these names: 4-(3,4-Dimethoxyphenyl)butyric acid, 95%, 4-(3,4-Dimethoxyphenyl)butanoic Acid, >95% (HPLC), 4-(3,4-Dimethoxyphenyl)butanoic acid, 97%, 4–(3,4–Dimethoxyphenyl)butyric acid, 4-(3,4-DIMETHOXYPHENYL)BUTYRIC ACID, 99%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
4-(3,4-dimethoxyphenyl)butanoic acid (CAS 13575-74-1) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)butanoic acid. InChIKey: IDQKCIAJGRMMNC-UHFFFAOYSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)butanoic acid |
| InChIKey | IDQKCIAJGRMMNC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCCC(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
4-(3,4-Dimethoxyphenyl)butanoic acid, 4-(3,4-Dimethoxyphenyl)butyric acid, 4-(3,4-dimethoxyphenyl)-butyric acid, Benzenebutanoic acid, 3,4-dimethoxy-, 4-(3,4-dimethoxy-phenyl)-butyric acid, 4-(3,4-dimethyloxyphenyl)butanoic acid, 4-(3,4-Dimethoxyphenyl)butanoic acid #, 4-Phenylbutyric acid, 4',5'-dimethoxy-, 4-(3,4-Dimethoxyphenyl)butyric acid, 99%