CAS 135754-82-4 appears in our catalog under these names: N-Methoxy-N,3-dimethylbenzamide, 95%, N-Methoxy-N,3-dimethylbenzamide, 95%, 95%, N-Methoxy-N,3-dimethylbenzamide, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 10g.
N-methoxy-N,3-dimethylbenzamide (CAS 135754-82-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: N-methoxy-N,3-dimethylbenzamide. InChIKey: KZITUZDRMDNBKI-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | N-methoxy-N,3-dimethylbenzamide |
| InChIKey | KZITUZDRMDNBKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)