CAS 1357600-18-0 is the registry number for Atorvastatin Impurity 87. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 1357600-18-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: DPNRMEJBKMQHMC-GHMZBOCLSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | DPNRMEJBKMQHMC-GHMZBOCLSA-N |
| SMILES | CC1(O[C@@H](C[C@@H](O1)CC(=O)OC(C)(C)C)CC#N)C |
Computed by PubChem (NCBI)