Products 1357600-18-0

CAS 1357600-18-0 is the registry number for Atorvastatin Impurity 87. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 1357600-18-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: DPNRMEJBKMQHMC-GHMZBOCLSA-N.

Identity
Molecular formulaC14H23NO4
Molecular weight269.34 g/mol
IUPAC nametert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
InChIKeyDPNRMEJBKMQHMC-GHMZBOCLSA-N
SMILESCC1(O[C@@H](C[C@@H](O1)CC(=O)OC(C)(C)C)CC#N)C

Computed by PubChem (NCBI)