CAS 196085-84-4 appears in our catalog under these names: Atorvastatin Impurity 19, Atorvastatin Impurity Z, Atorvastatin Impurity 61, (4R,6S)-6-(Cyanomethyl)-2,2-dimethyl--1,3-dioxane-4-acetic Acid tert-Butyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl 2-[(4R,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 196085-84-4) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 2-[(4R,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: DPNRMEJBKMQHMC-WDEREUQCSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6S)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | DPNRMEJBKMQHMC-WDEREUQCSA-N |
| SMILES | CC1(O[C@H](C[C@@H](O1)CC(=O)OC(C)(C)C)CC#N)C |
Computed by PubChem (NCBI)