Products 1357946-36-1
CAS 1357946-36-1 appears in our catalog under these names: 4-(Chloromethyl)-2-isopropoxypyridine hydrochloride, 95%, 4-(Chloromethyl)-2-isopropoxypyridine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-(chloromethyl)-2-propan-2-yloxypyridine;hydrochloride (CAS 1357946-36-1) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 4-(chloromethyl)-2-propan-2-yloxypyridine;hydrochloride. InChIKey: VLHDBMAILUWRIA-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 4-(chloromethyl)-2-propan-2-yloxypyridine;hydrochloride |
| InChIKey | VLHDBMAILUWRIA-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC=CC(=C1)CCl.Cl |
Computed by PubChem (NCBI)