Products 1956434-75-5
CAS 1956434-75-5 appears in our catalog under these names: (S)-Beta-(4-chlorophenyl)alaninol hydrochloride, 95%, (S)-2-Amino-3-(4-chlorophenyl)propan-1-ol hydrochloride, (S)-2-Amino-3-(4-chlorophenyl)propan-1-ol hydrochloride, 95%, 95%, (S)-2-Amino-3-(4-chlorophenyl)propan-1-ol hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 2,5g.
(2S)-2-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride (CAS 1956434-75-5) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: (2S)-2-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride. InChIKey: VLDWUIKCXWULET-FVGYRXGTSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | VLDWUIKCXWULET-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)