CAS 1820906-41-9 appears in our catalog under these names: 1-(4-Chlorophenyl)-2-methoxyethanamine hydrochloride, 95%, 1–(4–Chlorophenyl)–2–methoxyethanamine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
1-(4-chlorophenyl)-2-methoxyethanamine;hydrochloride (CAS 1820906-41-9) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-methoxyethanamine;hydrochloride. InChIKey: LVQQYJSSTLKYFW-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-methoxyethanamine;hydrochloride |
| InChIKey | LVQQYJSSTLKYFW-UHFFFAOYSA-N |
| SMILES | COCC(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)