CAS 35594-48-0 appears in our catalog under these names: 3-Chloro-4-isopropoxyaniline hydrochloride, 95%, 3-Chloro-4-isopropoxyaniline hydrochloride, 95+%, Aniline, 3-chloro-4-isopropoxy- (hydrochloride). Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g.
3-chloro-4-propan-2-yloxyaniline;hydrochloride (CAS 35594-48-0) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 3-chloro-4-propan-2-yloxyaniline;hydrochloride. InChIKey: ZPLFRRWEMXKFBK-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 3-chloro-4-propan-2-yloxyaniline;hydrochloride |
| InChIKey | ZPLFRRWEMXKFBK-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)N)Cl.Cl |
Computed by PubChem (NCBI)