Products 1359655-69-8
CAS 1359655-69-8 appears in our catalog under these names: tert-Butyl 2,5-diazaspiro(3.4)octane-2-carboxylate oxalate, 97%, tert-Butyl 2,5-diazaspiro[3.4]octane-2-carboxylate oxalate, 98%, 98%, tert-Butyl 2,5-diazaspiro[3.4]octane-2-carboxylate oxalate, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
Tert-butyl 2,5-diazaspiro[3.4]octane-2-carboxylate;oxalic acid (CAS 1359655-69-8) is a chemical compound with the molecular formula C13H22N2O6 and a molecular weight of 302.32 g/mol. IUPAC name: tert-butyl 2,5-diazaspiro[3.4]octane-2-carboxylate;oxalic acid. InChIKey: CKDFXVYACWODKL-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O6 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | tert-butyl 2,5-diazaspiro[3.4]octane-2-carboxylate;oxalic acid |
| InChIKey | CKDFXVYACWODKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Boc-2,5-diazaspiro[3.4]octane oxalate, tert-Butyl 2,5-diazaspiro[3.4]octane-2-carboxylate oxalate, tert-butyl 2,5-diazaspiro[3.4]octane-2-carboxylate;oxalic acid, 2,5-diazaspiro[3.4]octane-2-carboxylic acid tert-butyl ester oxalate, tert-Butyl2,5-diazaspiro[3.4]octane-2-carboxylateoxalate